C23H21F3N8O — CID 72549145
N-[4-[(3R,4S,5S)-3-amino-4-azido-5-methylpiperidin-1-yl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide (PubChem CID 72549145) has the molecular formula C23H21F3N8O and a molecular weight of 482.47 g/mol. Its IUPAC name is N-[4-[(3R,4S,5S)-3-amino-4-azido-5-methylpiperidin-1-yl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(3R,4S,5S)-3-amino-4-azido-5-methylpiperidin-1-yl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 72549145 |
| Molecular Formula | C23H21F3N8O |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-[4-[(3R,4S,5S)-3-amino-4-azido-5-methylpiperidin-1-yl]-3-pyridinyl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
| SMILES | C[C@H]1CN(c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cccc3F)n2)C[C@@H](N)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C23H21F3N8O/c1-12-10-34(11-16(27)21(12)32-33-28)19-7-8-29-9-18(19)31-23(35)17-6-5-15(26)22(30-17)20-13(24)3-2-4-14(20)25/h2-9,12,16,21H,10-11,27H2,1H3,(H,31,35)/t12-,16+,21-/m0/s1 |
| InChIKey | MJPYWISFUHSOCG-LSWYUMSHSA-N |
| XLogP | 4.28 |
| TPSA | 132.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|