About magnesium;(2-butyl-1-benzofuran-5-yl)-methylsulfonylazanide;chloride
magnesium;(2-butyl-1-benzofuran-5-yl)-methylsulfonylazanide;chloride (PubChem CID 72549163) has the molecular formula C13H16ClMgNO3S
and a molecular weight of 326.10 g/mol. Its IUPAC name is magnesium;(2-butyl-1-benzofuran-5-yl)-methylsulfonylazanide;chloride.
Molecular Properties
| Compound Name | magnesium;(2-butyl-1-benzofuran-5-yl)-methylsulfonylazanide;chloride |
| PubChem CID | 72549163 |
| Molecular Formula | C13H16ClMgNO3S |
| Molecular Weight | 326.10 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | magnesium;(2-butyl-1-benzofuran-5-yl)-methylsulfonylazanide;chloride |
| SMILES | CCCCc1cc2cc([N-]S(C)(=O)=O)ccc2o1.[Cl-].[Mg+2] |
| InChI | InChI=1S/C13H16NO3S.ClH.Mg/c1-3-4-5-12-9-10-8-11(14-18(2,15)16)6-7-13(10)17-12;;/h6-9H,3-5H2,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | OSULABLVNBNXCR-UHFFFAOYSA-M |
| XLogP | 0.36 |
| TPSA | 61.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.10 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze magnesium;(2-butyl-1-benzofuran-5-yl)-methylsulfonylazanide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;(2-butyl-1-benzofuran-5-yl)-methylsulfonylazanide;chloride?
The IUPAC name of magnesium;(2-butyl-1-benzofuran-5-yl)-methylsulfonylazanide;chloride (CID 72549163) is magnesium;(2-butyl-1-benzofuran-5-yl)-methylsulfonylazanide;chloride.
What is the SMILES notation for magnesium;(2-butyl-1-benzofuran-5-yl)-methylsulfonylazanide;chloride?
The canonical SMILES for magnesium;(2-butyl-1-benzofuran-5-yl)-methylsulfonylazanide;chloride is CCCCc1cc2cc([N-]S(C)(=O)=O)ccc2o1.[Cl-].[Mg+2].
What is the InChIKey of magnesium;(2-butyl-1-benzofuran-5-yl)-methylsulfonylazanide;chloride?
The InChIKey is OSULABLVNBNXCR-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H16NO3S.ClH.Mg/c1-3-4-5-12-9-10-8-11(14-18(2,15)16)6-7-13(10)17-12;;/h6-9H,3-5H2,1-2H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;(2-butyl-1-benzofuran-5-yl)-methylsulfonylazanide;chloride?
magnesium;(2-butyl-1-benzofuran-5-yl)-methylsulfonylazanide;chloride has a molecular weight of 326.10 g/mol, XLogP of 0.36, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;(2-butyl-1-benzofuran-5-yl)-methylsulfonylazanide;chloride is sourced from PubChem (CID 72549163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).