C26H36O7 — CID 72549723
[(4bS,8aS,9S,10S)-10-acetyloxy-1-hydroxy-4b,8,8-trimethyl-3,4-dioxo-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-9-yl] butanoate (PubChem CID 72549723) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is [(4bS,8aS,9S,10S)-10-acetyloxy-1-hydroxy-4b,8,8-trimethyl-3,4-dioxo-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-9-yl] butanoate.
| Compound Name | [(4bS,8aS,9S,10S)-10-acetyloxy-1-hydroxy-4b,8,8-trimethyl-3,4-dioxo-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-9-yl] butanoate |
|---|---|
| PubChem CID | 72549723 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | [(4bS,8aS,9S,10S)-10-acetyloxy-1-hydroxy-4b,8,8-trimethyl-3,4-dioxo-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-9-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1[C@@H](OC(C)=O)C2=C(C(=O)C(=O)C(C(C)C)=C2O)[C@@]2(C)CCCC(C)(C)[C@H]12 |
| InChI | InChI=1S/C26H36O7/c1-8-10-15(28)33-23-22(32-14(4)27)17-18(21(31)20(30)16(13(2)3)19(17)29)26(7)12-9-11-25(5,6)24(23)26/h13,22-24,29H,8-12H2,1-7H3/t22-,23+,24-,26+/m0/s1 |
| InChIKey | OBXQDRDRWWMAAD-CONSUNNSSA-N |
| XLogP | 4.39 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|