C26H20F4N6O3S — CID 72549854
[(4aR)-1-(4-fluorophenyl)-6-(1H-imidazol-5-ylsulfonyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-[4-(trifluoromethyl)-2-pyridinyl]methanone (PubChem CID 72549854) has the molecular formula C26H20F4N6O3S and a molecular weight of 572.54 g/mol. Its IUPAC name is [(4aR)-1-(4-fluorophenyl)-6-(1H-imidazol-5-ylsulfonyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-[4-(trifluoromethyl)-2-pyridinyl]methanone.
| Compound Name | [(4aR)-1-(4-fluorophenyl)-6-(1H-imidazol-5-ylsulfonyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-[4-(trifluoromethyl)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 72549854 |
| Molecular Formula | C26H20F4N6O3S |
| Molecular Weight | 572.54 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | [(4aR)-1-(4-fluorophenyl)-6-(1H-imidazol-5-ylsulfonyl)-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-[4-(trifluoromethyl)-2-pyridinyl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)ccn1)[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCN(S(=O)(=O)c1cnc[nH]1)C2 |
| InChI | InChI=1S/C26H20F4N6O3S/c27-19-1-3-20(4-2-19)36-22-10-17-6-8-35(40(38,39)23-13-31-15-33-23)14-25(17,11-16(22)12-34-36)24(37)21-9-18(5-7-32-21)26(28,29)30/h1-5,7,9-10,12-13,15H,6,8,11,14H2,(H,31,33)/t25-/m0/s1 |
| InChIKey | CVAFZWNMSPJAMY-VWLOTQADSA-N |
| XLogP | 4.05 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |