C19H28N4O — CID 72550075
1-[2-imino-3-(2-piperidin-1-ylethyl)benzimidazol-1-yl]-3-methylbutan-2-one (PubChem CID 72550075) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-[2-imino-3-(2-piperidin-1-ylethyl)benzimidazol-1-yl]-3-methylbutan-2-one.
| Compound Name | 1-[2-imino-3-(2-piperidin-1-ylethyl)benzimidazol-1-yl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 72550075 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 1-[2-imino-3-(2-piperidin-1-ylethyl)benzimidazol-1-yl]-3-methylbutan-2-one |
| SMILES | [H]/N=c1\n(CCN2CCCCC2)c2ccccc2n1CC(=O)C(C)C |
| InChI | InChI=1S/C19H28N4O/c1-15(2)18(24)14-23-17-9-5-4-8-16(17)22(19(23)20)13-12-21-10-6-3-7-11-21/h4-5,8-9,15,20H,3,6-7,10-14H2,1-2H3/b20-19+ |
| InChIKey | YJQTZGAUFUDJLF-FMQUCBEESA-N |
| XLogP | 2.63 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |