About N-(4-chlorophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-amine
N-(4-chlorophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-amine (PubChem CID 72550225) has the molecular formula C17H23ClN4O2S
and a molecular weight of 382.92 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-amine.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-amine |
| PubChem CID | 72550225 |
| Molecular Formula | C17H23ClN4O2S |
| Molecular Weight | 382.92 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N-(4-chlorophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-amine |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N1CCC(Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H23ClN4O2S/c1-12-17(13(2)21(3)20-12)25(23,24)22-10-8-16(9-11-22)19-15-6-4-14(18)5-7-15/h4-7,16,19H,8-11H2,1-3H3 |
| InChIKey | AIWRATIZFHITQS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.92 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-chlorophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-amine?
The IUPAC name of N-(4-chlorophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-amine (CID 72550225) is N-(4-chlorophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-amine.
What is the SMILES notation for N-(4-chlorophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-amine?
The canonical SMILES for N-(4-chlorophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-amine is Cc1nn(C)c(C)c1S(=O)(=O)N1CCC(Nc2ccc(Cl)cc2)CC1.
What is the InChIKey of N-(4-chlorophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-amine?
The InChIKey is AIWRATIZFHITQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23ClN4O2S/c1-12-17(13(2)21(3)20-12)25(23,24)22-10-8-16(9-11-22)19-15-6-4-14(18)5-7-15/h4-7,16,19H,8-11H2,1-3H3.
What are the key properties of N-(4-chlorophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-amine?
N-(4-chlorophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-amine has a molecular weight of 382.92 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-amine is sourced from PubChem (CID 72550225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).