C30H28FN5O3S2 — CID 72550508
[(4aR)-1-(4-fluorophenyl)-6-(4-pyrrolidin-1-ylphenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone (PubChem CID 72550508) has the molecular formula C30H28FN5O3S2 and a molecular weight of 589.72 g/mol. Its IUPAC name is [(4aR)-1-(4-fluorophenyl)-6-(4-pyrrolidin-1-ylphenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone.
| Compound Name | [(4aR)-1-(4-fluorophenyl)-6-(4-pyrrolidin-1-ylphenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 72550508 |
| Molecular Formula | C30H28FN5O3S2 |
| Molecular Weight | 589.72 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | [(4aR)-1-(4-fluorophenyl)-6-(4-pyrrolidin-1-ylphenyl)sulfonyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanone |
| SMILES | O=C(c1nccs1)[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCN(S(=O)(=O)c1ccc(N3CCCC3)cc1)C2 |
| InChI | InChI=1S/C30H28FN5O3S2/c31-23-3-5-25(6-4-23)36-27-17-22-11-15-35(41(38,39)26-9-7-24(8-10-26)34-13-1-2-14-34)20-30(22,18-21(27)19-33-36)28(37)29-32-12-16-40-29/h3-10,12,16-17,19H,1-2,11,13-15,18,20H2/t30-/m0/s1 |
| InChIKey | JQCRWRPRXGZBTG-PMERELPUSA-N |
| XLogP | 4.97 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.72 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |