C34H40N5O6P — CID 72550807
(2R,15R)-2-[(1-aminoisoquinolin-6-yl)amino]-7-diethoxyphosphoryl-4,15,17-trimethyl-13-oxa-4,11-diazatricyclo[14.2.2.16,10]henicosa-1(18),6,8,10(21),16,19-hexaene-3,12-dione (PubChem CID 72550807) has the molecular formula C34H40N5O6P and a molecular weight of 645.70 g/mol. Its IUPAC name is (2R,15R)-2-[(1-aminoisoquinolin-6-yl)amino]-7-diethoxyphosphoryl-4,15,17-trimethyl-13-oxa-4,11-diazatricyclo[14.2.2.16,10]henicosa-1(18),6,8,10(21),16,19-hexaene-3,12-dione.
| Compound Name | (2R,15R)-2-[(1-aminoisoquinolin-6-yl)amino]-7-diethoxyphosphoryl-4,15,17-trimethyl-13-oxa-4,11-diazatricyclo[14.2.2.16,10]henicosa-1(18),6,8,10(21),16,19-hexaene-3,12-dione |
|---|---|
| PubChem CID | 72550807 |
| Molecular Formula | C34H40N5O6P |
| Molecular Weight | 645.70 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | (2R,15R)-2-[(1-aminoisoquinolin-6-yl)amino]-7-diethoxyphosphoryl-4,15,17-trimethyl-13-oxa-4,11-diazatricyclo[14.2.2.16,10]henicosa-1(18),6,8,10(21),16,19-hexaene-3,12-dione |
| SMILES | CCOP(=O)(OCC)c1ccc2cc1CN(C)C(=O)[C@H](Nc1ccc3c(N)nccc3c1)c1ccc(c(C)c1)[C@@H](C)COC(=O)N2 |
| InChI | InChI=1S/C34H40N5O6P/c1-6-44-46(42,45-7-2)30-13-10-27-18-25(30)19-39(5)33(40)31(37-26-9-12-29-23(17-26)14-15-36-32(29)35)24-8-11-28(21(3)16-24)22(4)20-43-34(41)38-27/h8-18,22,31,37H,6-7,19-20H2,1-5H3,(H2,35,36)(H,38,41)/t22-,31+/m0/s1 |
| InChIKey | YIXUXJDCYJOAHT-WKRVVKTRSA-N |
| XLogP | 6.49 |
| TPSA | 145.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.70 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|