C22H31FN6O — CID 72551070
4-[(4-aminocyclohexyl)methylamino]-2-(butylamino)-N-(4-fluorophenyl)pyrimidine-5-carboxamide (PubChem CID 72551070) has the molecular formula C22H31FN6O and a molecular weight of 414.53 g/mol. Its IUPAC name is 4-[(4-aminocyclohexyl)methylamino]-2-(butylamino)-N-(4-fluorophenyl)pyrimidine-5-carboxamide.
| Compound Name | 4-[(4-aminocyclohexyl)methylamino]-2-(butylamino)-N-(4-fluorophenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 72551070 |
| Molecular Formula | C22H31FN6O |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 4-[(4-aminocyclohexyl)methylamino]-2-(butylamino)-N-(4-fluorophenyl)pyrimidine-5-carboxamide |
| SMILES | CCCCNc1ncc(C(=O)Nc2ccc(F)cc2)c(NCC2CCC(N)CC2)n1 |
| InChI | InChI=1S/C22H31FN6O/c1-2-3-12-25-22-27-14-19(21(30)28-18-10-6-16(23)7-11-18)20(29-22)26-13-15-4-8-17(24)9-5-15/h6-7,10-11,14-15,17H,2-5,8-9,12-13,24H2,1H3,(H,28,30)(H2,25,26,27,29) |
| InChIKey | WRYYRMHEPCBQIZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|