About 1-(6-tert-butyl-3,4,5-trihydroxyoxan-2-yl)ethanone
1-(6-tert-butyl-3,4,5-trihydroxyoxan-2-yl)ethanone (PubChem CID 72555290) has the molecular formula C11H20O5
and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-(6-tert-butyl-3,4,5-trihydroxyoxan-2-yl)ethanone.
Molecular Properties
| Compound Name | 1-(6-tert-butyl-3,4,5-trihydroxyoxan-2-yl)ethanone |
| PubChem CID | 72555290 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1-(6-tert-butyl-3,4,5-trihydroxyoxan-2-yl)ethanone |
| SMILES | CC(=O)C1OC(C(C)(C)C)C(O)C(O)C1O |
| InChI | InChI=1S/C11H20O5/c1-5(12)9-7(14)6(13)8(15)10(16-9)11(2,3)4/h6-10,13-15H,1-4H3 |
| InChIKey | RUNQSOKIBMLUSL-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(6-tert-butyl-3,4,5-trihydroxyoxan-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-tert-butyl-3,4,5-trihydroxyoxan-2-yl)ethanone?
The IUPAC name of 1-(6-tert-butyl-3,4,5-trihydroxyoxan-2-yl)ethanone (CID 72555290) is 1-(6-tert-butyl-3,4,5-trihydroxyoxan-2-yl)ethanone.
What is the SMILES notation for 1-(6-tert-butyl-3,4,5-trihydroxyoxan-2-yl)ethanone?
The canonical SMILES for 1-(6-tert-butyl-3,4,5-trihydroxyoxan-2-yl)ethanone is CC(=O)C1OC(C(C)(C)C)C(O)C(O)C1O.
What is the InChIKey of 1-(6-tert-butyl-3,4,5-trihydroxyoxan-2-yl)ethanone?
The InChIKey is RUNQSOKIBMLUSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O5/c1-5(12)9-7(14)6(13)8(15)10(16-9)11(2,3)4/h6-10,13-15H,1-4H3.
What are the key properties of 1-(6-tert-butyl-3,4,5-trihydroxyoxan-2-yl)ethanone?
1-(6-tert-butyl-3,4,5-trihydroxyoxan-2-yl)ethanone has a molecular weight of 232.28 g/mol, XLogP of -0.53, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-tert-butyl-3,4,5-trihydroxyoxan-2-yl)ethanone is sourced from PubChem (CID 72555290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).