About 2-(6-methoxy-4,4-dimethylhexa-2,5-dien-3-yl)aniline
2-(6-methoxy-4,4-dimethylhexa-2,5-dien-3-yl)aniline (PubChem CID 72556668) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-(6-methoxy-4,4-dimethylhexa-2,5-dien-3-yl)aniline.
Molecular Properties
| Compound Name | 2-(6-methoxy-4,4-dimethylhexa-2,5-dien-3-yl)aniline |
| PubChem CID | 72556668 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-(6-methoxy-4,4-dimethylhexa-2,5-dien-3-yl)aniline |
| SMILES | CC=C(c1ccccc1N)C(C)(C)C=COC |
| InChI | InChI=1S/C15H21NO/c1-5-13(15(2,3)10-11-17-4)12-8-6-7-9-14(12)16/h5-11H,16H2,1-4H3 |
| InChIKey | VBCCVBUPMYUYAH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-methoxy-4,4-dimethylhexa-2,5-dien-3-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methoxy-4,4-dimethylhexa-2,5-dien-3-yl)aniline?
The IUPAC name of 2-(6-methoxy-4,4-dimethylhexa-2,5-dien-3-yl)aniline (CID 72556668) is 2-(6-methoxy-4,4-dimethylhexa-2,5-dien-3-yl)aniline.
What is the SMILES notation for 2-(6-methoxy-4,4-dimethylhexa-2,5-dien-3-yl)aniline?
The canonical SMILES for 2-(6-methoxy-4,4-dimethylhexa-2,5-dien-3-yl)aniline is CC=C(c1ccccc1N)C(C)(C)C=COC.
What is the InChIKey of 2-(6-methoxy-4,4-dimethylhexa-2,5-dien-3-yl)aniline?
The InChIKey is VBCCVBUPMYUYAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO/c1-5-13(15(2,3)10-11-17-4)12-8-6-7-9-14(12)16/h5-11H,16H2,1-4H3.
What are the key properties of 2-(6-methoxy-4,4-dimethylhexa-2,5-dien-3-yl)aniline?
2-(6-methoxy-4,4-dimethylhexa-2,5-dien-3-yl)aniline has a molecular weight of 231.34 g/mol, XLogP of 3.86, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methoxy-4,4-dimethylhexa-2,5-dien-3-yl)aniline is sourced from PubChem (CID 72556668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).