C8H10F6N2 — CID 72560389
1,1,1,5,5,5-hexafluoro-N,N-dimethyl-4-methyliminopent-2-en-2-amine (PubChem CID 72560389) has the molecular formula C8H10F6N2 and a molecular weight of 248.17 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-N,N-dimethyl-4-methyliminopent-2-en-2-amine.
| Compound Name | 1,1,1,5,5,5-hexafluoro-N,N-dimethyl-4-methyliminopent-2-en-2-amine |
|---|---|
| PubChem CID | 72560389 |
| Molecular Formula | C8H10F6N2 |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-N,N-dimethyl-4-methyliminopent-2-en-2-amine |
| SMILES | C/N=C(/C=C(N(C)C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H10F6N2/c1-15-5(7(9,10)11)4-6(16(2)3)8(12,13)14/h4H,1-3H3/b6-4?,15-5- |
| InChIKey | NQDXLWUFEYDJMO-QEWLNAPWSA-N |
| XLogP | 2.63 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|