C10H13N3O2 — CID 725639
2-ethyl-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile (PubChem CID 725639) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-ethyl-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-ethyl-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 725639 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2-ethyl-5-morpholin-4-yl-1,3-oxazole-4-carbonitrile |
| SMILES | CCc1nc(C#N)c(N2CCOCC2)o1 |
| InChI | InChI=1S/C10H13N3O2/c1-2-9-12-8(7-11)10(15-9)13-3-5-14-6-4-13/h2-6H2,1H3 |
| InChIKey | JUZXLMUBQZMETP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 62.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |