(1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid

C10H8O3 — CID 725641

IUPAC(1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid
SMILESO=C1C[C@H](C(=O)O)c2ccccc21
InChIInChI=1S/C10H8O3/c11-9-5-8(10(12)13)6-3-1-2-4-7(6)9/h1-4,8H,5H2,(H,12,13)/t8-/m0/s1
InChIKeyHXLJFMRZKCSTQD-QMMMGPOBSA-N
MW176.17 g/mol
LogP1.44
Rot. Bonds1

About (1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid

(1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid (PubChem CID 725641) has the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. Its IUPAC name is (1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid.

Molecular Properties

Compound Name(1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid
PubChem CID725641
Molecular FormulaC10H8O3
Molecular Weight176.17 g/mol
Exact Mass176.05
IUPAC Name(1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid
SMILESO=C1C[C@H](C(=O)O)c2ccccc21
InChIInChI=1S/C10H8O3/c11-9-5-8(10(12)13)6-3-1-2-4-7(6)9/h1-4,8H,5H2,(H,12,13)/t8-/m0/s1
InChIKeyHXLJFMRZKCSTQD-QMMMGPOBSA-N
XLogP1.44
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.17
LogP ≤ 51.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid?
The IUPAC name of (1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid (CID 725641) is (1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid.
What is the SMILES notation for (1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid?
The canonical SMILES for (1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid is O=C1C[C@H](C(=O)O)c2ccccc21.
What is the InChIKey of (1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid?
The InChIKey is HXLJFMRZKCSTQD-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H8O3/c11-9-5-8(10(12)13)6-3-1-2-4-7(6)9/h1-4,8H,5H2,(H,12,13)/t8-/m0/s1.
What are the key properties of (1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid?
(1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid has a molecular weight of 176.17 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid is sourced from PubChem (CID 725641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).