C21H18N4O3 — CID 72564514
N-(furan-2-ylmethyl)-4-methoxy-3-(2-pyridin-4-ylethenyl)-1H-indazole-5-carboxamide (PubChem CID 72564514) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-methoxy-3-(2-pyridin-4-ylethenyl)-1H-indazole-5-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-4-methoxy-3-(2-pyridin-4-ylethenyl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 72564514 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-methoxy-3-(2-pyridin-4-ylethenyl)-1H-indazole-5-carboxamide |
| SMILES | COc1c(C(=O)NCc2ccco2)ccc2[nH]nc(C=Cc3ccncc3)c12 |
| InChI | InChI=1S/C21H18N4O3/c1-27-20-16(21(26)23-13-15-3-2-12-28-15)5-7-18-19(20)17(24-25-18)6-4-14-8-10-22-11-9-14/h2-12H,13H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | HUAQWCVNNPMNJE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |