C34H45NO5S — CID 72565746
[[[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]-phenylmethylidene]amino] 2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 72565746) has the molecular formula C34H45NO5S and a molecular weight of 579.80 g/mol. Its IUPAC name is [[[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]-phenylmethylidene]amino] 2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | [[[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]-phenylmethylidene]amino] 2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 72565746 |
| Molecular Formula | C34H45NO5S |
| Molecular Weight | 579.80 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | [[[4-(1-hydroperoxy-2,2-dimethylbutyl)phenyl]-phenylmethylidene]amino] 2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | CCC(C)(C)C(OO)c1ccc(C(=NOS(=O)(=O)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H45NO5S/c1-10-34(8,9)33(39-36)27-18-16-26(17-19-27)31(25-14-12-11-13-15-25)35-40-41(37,38)32-29(23(4)5)20-28(22(2)3)21-30(32)24(6)7/h11-24,33,36H,10H2,1-9H3 |
| InChIKey | SWPSHYHDRGNNPB-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.80 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|