C15H13N3OS — CID 7256677
2-(2-phenylethylsulfanyl)pyrido[1,2-a][1,3,5]triazin-4-one (PubChem CID 7256677) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is 2-(2-phenylethylsulfanyl)pyrido[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 2-(2-phenylethylsulfanyl)pyrido[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 7256677 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-(2-phenylethylsulfanyl)pyrido[1,2-a][1,3,5]triazin-4-one |
| SMILES | O=c1nc(SCCc2ccccc2)nc2ccccn12 |
| InChI | InChI=1S/C15H13N3OS/c19-15-17-14(16-13-8-4-5-10-18(13)15)20-11-9-12-6-2-1-3-7-12/h1-8,10H,9,11H2 |
| InChIKey | IPFYWGJASMBEJW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |