C42H59NO4 — CID 72566803
1-O-tert-butyl 2-O-(2,6,10,14,19,23-hexamethylhexacosa-2,6,8,10,12,14,16,18,20,22,24-undecaenyl) pyrrolidine-1,2-dicarboxylate (PubChem CID 72566803) has the molecular formula C42H59NO4 and a molecular weight of 641.94 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-(2,6,10,14,19,23-hexamethylhexacosa-2,6,8,10,12,14,16,18,20,22,24-undecaenyl) pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-(2,6,10,14,19,23-hexamethylhexacosa-2,6,8,10,12,14,16,18,20,22,24-undecaenyl) pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 72566803 |
| Molecular Formula | C42H59NO4 |
| Molecular Weight | 641.94 g/mol |
| Exact Mass | 641.44 |
| IUPAC Name | 1-O-tert-butyl 2-O-(2,6,10,14,19,23-hexamethylhexacosa-2,6,8,10,12,14,16,18,20,22,24-undecaenyl) pyrrolidine-1,2-dicarboxylate |
| SMILES | CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)COC(=O)C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C42H59NO4/c1-11-19-33(2)22-14-23-34(3)20-12-13-21-35(4)24-15-25-36(5)26-16-27-37(6)28-17-29-38(7)32-46-40(44)39-30-18-31-43(39)41(45)47-42(8,9)10/h11-16,19-27,29,39H,17-18,28,30-32H2,1-10H3 |
| InChIKey | ZEHTVCCQFDHQIQ-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.94 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|