C48H48N4 — CID 72572180
10,20-bis(4-methylcyclohexa-2,4-dien-1-yl)-5,15-bis(4-methylphenyl)-1,2,16,19,20,21,22,24-octahydroporphyrin (PubChem CID 72572180) has the molecular formula C48H48N4 and a molecular weight of 680.94 g/mol. Its IUPAC name is 10,20-bis(4-methylcyclohexa-2,4-dien-1-yl)-5,15-bis(4-methylphenyl)-1,2,16,19,20,21,22,24-octahydroporphyrin.
| Compound Name | 10,20-bis(4-methylcyclohexa-2,4-dien-1-yl)-5,15-bis(4-methylphenyl)-1,2,16,19,20,21,22,24-octahydroporphyrin |
|---|---|
| PubChem CID | 72572180 |
| Molecular Formula | C48H48N4 |
| Molecular Weight | 680.94 g/mol |
| Exact Mass | 680.39 |
| IUPAC Name | 10,20-bis(4-methylcyclohexa-2,4-dien-1-yl)-5,15-bis(4-methylphenyl)-1,2,16,19,20,21,22,24-octahydroporphyrin |
| SMILES | CC1=CCC(C2=c3ccc([nH]3)=C(c3ccc(C)cc3)C3=CCC(N3)C(C3C=CC(C)=CC3)C3C=CC(N3)C(c3ccc(C)cc3)=C3C=CC2=N3)C=C1 |
| InChI | InChI=1S/C48H48N4/c1-29-5-13-33(14-6-29)45-37-21-23-39(49-37)46(34-15-7-30(2)8-16-34)41-25-27-43(51-41)48(36-19-11-32(4)12-20-36)44-28-26-42(52-44)47(40-24-22-38(45)50-40)35-17-9-31(3)10-18-35/h5-15,17,19-25,27-28,34-35,38,40,42,47,50-52H,16,18,26H2,1-4H3 |
| InChIKey | ZEQLVWGJTNFYKY-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.94 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|