C16H16N4 — CID 725764
3,6-dibenzyl-1,4-dihydro-1,2,4,5-tetrazine (PubChem CID 725764) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is 3,6-dibenzyl-1,4-dihydro-1,2,4,5-tetrazine.
| Compound Name | 3,6-dibenzyl-1,4-dihydro-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 725764 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 3,6-dibenzyl-1,4-dihydro-1,2,4,5-tetrazine |
| SMILES | c1ccc(CC2=NNC(Cc3ccccc3)=NN2)cc1 |
| InChI | InChI=1S/C16H16N4/c1-3-7-13(8-4-1)11-15-17-19-16(20-18-15)12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,17,18)(H,19,20) |
| InChIKey | JOCZFBNLJSBBIL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |