About 5-ethylidene-2,3-dimethylbicyclo[2.2.1]heptane
5-ethylidene-2,3-dimethylbicyclo[2.2.1]heptane (PubChem CID 72580180) has the molecular formula C11H18
and a molecular weight of 150.27 g/mol. Its IUPAC name is 5-ethylidene-2,3-dimethylbicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 5-ethylidene-2,3-dimethylbicyclo[2.2.1]heptane |
| PubChem CID | 72580180 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 5-ethylidene-2,3-dimethylbicyclo[2.2.1]heptane |
| SMILES | CC=C1CC2CC1C(C)C2C |
| InChI | InChI=1S/C11H18/c1-4-9-5-10-6-11(9)8(3)7(10)2/h4,7-8,10-11H,5-6H2,1-3H3 |
| InChIKey | DSZLOJJMQQDRDP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethylidene-2,3-dimethylbicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylidene-2,3-dimethylbicyclo[2.2.1]heptane?
The IUPAC name of 5-ethylidene-2,3-dimethylbicyclo[2.2.1]heptane (CID 72580180) is 5-ethylidene-2,3-dimethylbicyclo[2.2.1]heptane.
What is the SMILES notation for 5-ethylidene-2,3-dimethylbicyclo[2.2.1]heptane?
The canonical SMILES for 5-ethylidene-2,3-dimethylbicyclo[2.2.1]heptane is CC=C1CC2CC1C(C)C2C.
What is the InChIKey of 5-ethylidene-2,3-dimethylbicyclo[2.2.1]heptane?
The InChIKey is DSZLOJJMQQDRDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18/c1-4-9-5-10-6-11(9)8(3)7(10)2/h4,7-8,10-11H,5-6H2,1-3H3.
What are the key properties of 5-ethylidene-2,3-dimethylbicyclo[2.2.1]heptane?
5-ethylidene-2,3-dimethylbicyclo[2.2.1]heptane has a molecular weight of 150.27 g/mol, XLogP of 3.24, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylidene-2,3-dimethylbicyclo[2.2.1]heptane is sourced from PubChem (CID 72580180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).