About ethyl 2-methoxyiminopropanoate
ethyl 2-methoxyiminopropanoate (PubChem CID 72583481) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is ethyl 2-methoxyiminopropanoate.
Molecular Properties
| Compound Name | ethyl 2-methoxyiminopropanoate |
| PubChem CID | 72583481 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | ethyl 2-methoxyiminopropanoate |
| SMILES | CCOC(=O)C(C)=NOC |
| InChI | InChI=1S/C6H11NO3/c1-4-10-6(8)5(2)7-9-3/h4H2,1-3H3 |
| InChIKey | IUFUCDQOMAJCJG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-methoxyiminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methoxyiminopropanoate?
The IUPAC name of ethyl 2-methoxyiminopropanoate (CID 72583481) is ethyl 2-methoxyiminopropanoate.
What is the SMILES notation for ethyl 2-methoxyiminopropanoate?
The canonical SMILES for ethyl 2-methoxyiminopropanoate is CCOC(=O)C(C)=NOC.
What is the InChIKey of ethyl 2-methoxyiminopropanoate?
The InChIKey is IUFUCDQOMAJCJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3/c1-4-10-6(8)5(2)7-9-3/h4H2,1-3H3.
What are the key properties of ethyl 2-methoxyiminopropanoate?
ethyl 2-methoxyiminopropanoate has a molecular weight of 145.16 g/mol, XLogP of 0.57, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methoxyiminopropanoate is sourced from PubChem (CID 72583481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).