About (2R)-2-methyl-3-(3,4,5-trimethylpyrazol-1-yl)propanoic acid
(2R)-2-methyl-3-(3,4,5-trimethylpyrazol-1-yl)propanoic acid (PubChem CID 7258416) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is (2R)-2-methyl-3-(3,4,5-trimethylpyrazol-1-yl)propanoic acid.
Analyze (2R)-2-methyl-3-(3,4,5-trimethylpyrazol-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methyl-3-(3,4,5-trimethylpyrazol-1-yl)propanoic acid?
The IUPAC name of (2R)-2-methyl-3-(3,4,5-trimethylpyrazol-1-yl)propanoic acid (CID 7258416) is (2R)-2-methyl-3-(3,4,5-trimethylpyrazol-1-yl)propanoic acid.
What is the SMILES notation for (2R)-2-methyl-3-(3,4,5-trimethylpyrazol-1-yl)propanoic acid?
The canonical SMILES for (2R)-2-methyl-3-(3,4,5-trimethylpyrazol-1-yl)propanoic acid is Cc1nn(C[C@@H](C)C(=O)O)c(C)c1C.
What is the InChIKey of (2R)-2-methyl-3-(3,4,5-trimethylpyrazol-1-yl)propanoic acid?
The InChIKey is FSZIWKPHMFVUFJ-ZCFIWIBFSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-6(10(13)14)5-12-9(4)7(2)8(3)11-12/h6H,5H2,1-4H3,(H,13,14)/t6-/m1/s1.
What are the key properties of (2R)-2-methyl-3-(3,4,5-trimethylpyrazol-1-yl)propanoic acid?
(2R)-2-methyl-3-(3,4,5-trimethylpyrazol-1-yl)propanoic acid has a molecular weight of 196.25 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methyl-3-(3,4,5-trimethylpyrazol-1-yl)propanoic acid is sourced from PubChem (CID 7258416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).