About 2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethenyl]-5-pentylpyrimidine
2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethenyl]-5-pentylpyrimidine (PubChem CID 72585161) has the molecular formula C15H20F2N2O2
and a molecular weight of 298.33 g/mol. Its IUPAC name is 2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethenyl]-5-pentylpyrimidine.
Molecular Properties
| Compound Name | 2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethenyl]-5-pentylpyrimidine |
| PubChem CID | 72585161 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethenyl]-5-pentylpyrimidine |
| SMILES | CCCCCc1cnc(C=CC2COC(F)(F)OC2)nc1 |
| InChI | InChI=1S/C15H20F2N2O2/c1-2-3-4-5-12-8-18-14(19-9-12)7-6-13-10-20-15(16,17)21-11-13/h6-9,13H,2-5,10-11H2,1H3 |
| InChIKey | IXEXAVTYJSBWTR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethenyl]-5-pentylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethenyl]-5-pentylpyrimidine?
The IUPAC name of 2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethenyl]-5-pentylpyrimidine (CID 72585161) is 2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethenyl]-5-pentylpyrimidine.
What is the SMILES notation for 2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethenyl]-5-pentylpyrimidine?
The canonical SMILES for 2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethenyl]-5-pentylpyrimidine is CCCCCc1cnc(C=CC2COC(F)(F)OC2)nc1.
What is the InChIKey of 2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethenyl]-5-pentylpyrimidine?
The InChIKey is IXEXAVTYJSBWTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F2N2O2/c1-2-3-4-5-12-8-18-14(19-9-12)7-6-13-10-20-15(16,17)21-11-13/h6-9,13H,2-5,10-11H2,1H3.
What are the key properties of 2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethenyl]-5-pentylpyrimidine?
2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethenyl]-5-pentylpyrimidine has a molecular weight of 298.33 g/mol, XLogP of 3.44, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,2-difluoro-1,3-dioxan-5-yl)ethenyl]-5-pentylpyrimidine is sourced from PubChem (CID 72585161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).