C14H19N3O2 — CID 7258600
(5S,7R)-3-(3-methyl-1,2,4-triazol-1-yl)adamantane-1-carboxylic acid (PubChem CID 7258600) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is (5S,7R)-3-(3-methyl-1,2,4-triazol-1-yl)adamantane-1-carboxylic acid.
| Compound Name | (5S,7R)-3-(3-methyl-1,2,4-triazol-1-yl)adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 7258600 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (5S,7R)-3-(3-methyl-1,2,4-triazol-1-yl)adamantane-1-carboxylic acid |
| SMILES | Cc1ncn(C23C[C@@H]4C[C@@H](CC(C(=O)O)(C4)C2)C3)n1 |
| InChI | InChI=1S/C14H19N3O2/c1-9-15-8-17(16-9)14-5-10-2-11(6-14)4-13(3-10,7-14)12(18)19/h8,10-11H,2-7H2,1H3,(H,18,19)/t10-,11+,13?,14? |
| InChIKey | DNPCEUBJGPSDRU-WHCAJBEMSA-N |
| XLogP | 1.97 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |