About 1-(4-hexa-1,3,5-trien-2-yloxybutyl)piperidine
1-(4-hexa-1,3,5-trien-2-yloxybutyl)piperidine (PubChem CID 72586536) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is 1-(4-hexa-1,3,5-trien-2-yloxybutyl)piperidine.
Molecular Properties
| Compound Name | 1-(4-hexa-1,3,5-trien-2-yloxybutyl)piperidine |
| PubChem CID | 72586536 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 1-(4-hexa-1,3,5-trien-2-yloxybutyl)piperidine |
| SMILES | C=CC=CC(=C)OCCCCN1CCCCC1 |
| InChI | InChI=1S/C15H25NO/c1-3-4-10-15(2)17-14-9-8-13-16-11-6-5-7-12-16/h3-4,10H,1-2,5-9,11-14H2 |
| InChIKey | PRUCVEYVLYFZRR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-hexa-1,3,5-trien-2-yloxybutyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-hexa-1,3,5-trien-2-yloxybutyl)piperidine?
The IUPAC name of 1-(4-hexa-1,3,5-trien-2-yloxybutyl)piperidine (CID 72586536) is 1-(4-hexa-1,3,5-trien-2-yloxybutyl)piperidine.
What is the SMILES notation for 1-(4-hexa-1,3,5-trien-2-yloxybutyl)piperidine?
The canonical SMILES for 1-(4-hexa-1,3,5-trien-2-yloxybutyl)piperidine is C=CC=CC(=C)OCCCCN1CCCCC1.
What is the InChIKey of 1-(4-hexa-1,3,5-trien-2-yloxybutyl)piperidine?
The InChIKey is PRUCVEYVLYFZRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO/c1-3-4-10-15(2)17-14-9-8-13-16-11-6-5-7-12-16/h3-4,10H,1-2,5-9,11-14H2.
What are the key properties of 1-(4-hexa-1,3,5-trien-2-yloxybutyl)piperidine?
1-(4-hexa-1,3,5-trien-2-yloxybutyl)piperidine has a molecular weight of 235.37 g/mol, XLogP of 3.53, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-hexa-1,3,5-trien-2-yloxybutyl)piperidine is sourced from PubChem (CID 72586536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).