About but-1-ene-1,3-diamine
but-1-ene-1,3-diamine (PubChem CID 72586665) has the molecular formula C4H10N2
and a molecular weight of 86.14 g/mol. Its IUPAC name is but-1-ene-1,3-diamine.
Molecular Properties
| Compound Name | but-1-ene-1,3-diamine |
| PubChem CID | 72586665 |
| Molecular Formula | C4H10N2 |
| Molecular Weight | 86.14 g/mol |
| Exact Mass | 86.08 |
| IUPAC Name | but-1-ene-1,3-diamine |
| SMILES | CC(N)C=CN |
| InChI | InChI=1S/C4H10N2/c1-4(6)2-3-5/h2-4H,5-6H2,1H3 |
| InChIKey | XIDPCCXRVFWISI-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.14 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze but-1-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene-1,3-diamine?
The IUPAC name of but-1-ene-1,3-diamine (CID 72586665) is but-1-ene-1,3-diamine.
What is the SMILES notation for but-1-ene-1,3-diamine?
The canonical SMILES for but-1-ene-1,3-diamine is CC(N)C=CN.
What is the InChIKey of but-1-ene-1,3-diamine?
The InChIKey is XIDPCCXRVFWISI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2/c1-4(6)2-3-5/h2-4H,5-6H2,1H3.
What are the key properties of but-1-ene-1,3-diamine?
but-1-ene-1,3-diamine has a molecular weight of 86.14 g/mol, XLogP of -0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene-1,3-diamine is sourced from PubChem (CID 72586665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).