C11H17FN2O — CID 72586931
4-(3-fluoro-4-isocyanobut-2-enyl)-2,2,3-trimethyl-1,3-oxazolidine (PubChem CID 72586931) has the molecular formula C11H17FN2O and a molecular weight of 212.27 g/mol. Its IUPAC name is 4-(3-fluoro-4-isocyanobut-2-enyl)-2,2,3-trimethyl-1,3-oxazolidine.
| Compound Name | 4-(3-fluoro-4-isocyanobut-2-enyl)-2,2,3-trimethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 72586931 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 4-(3-fluoro-4-isocyanobut-2-enyl)-2,2,3-trimethyl-1,3-oxazolidine |
| SMILES | [C-]#[N+]CC(F)=CCC1COC(C)(C)N1C |
| InChI | InChI=1S/C11H17FN2O/c1-11(2)14(4)10(8-15-11)6-5-9(12)7-13-3/h5,10H,6-8H2,1-2,4H3 |
| InChIKey | QKWZRRIRLHAFJI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 16.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|