C9H15N — CID 7258814
(2S,6S)-6-methyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine (PubChem CID 7258814) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is (2S,6S)-6-methyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine.
| Compound Name | (2S,6S)-6-methyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 7258814 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (2S,6S)-6-methyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine |
| SMILES | C=CC[C@H]1CC=C[C@H](C)N1 |
| InChI | InChI=1S/C9H15N/c1-3-5-9-7-4-6-8(2)10-9/h3-4,6,8-10H,1,5,7H2,2H3/t8-,9-/m0/s1 |
| InChIKey | PSNCFOFVFFJWLI-IUCAKERBSA-N |
| XLogP | 1.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|