C22H23N3O3 — CID 7258924
(2S,6R,7R)-4-(3-methoxyphenyl)-7-(4-methylphenyl)-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione (PubChem CID 7258924) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is (2S,6R,7R)-4-(3-methoxyphenyl)-7-(4-methylphenyl)-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione.
| Compound Name | (2S,6R,7R)-4-(3-methoxyphenyl)-7-(4-methylphenyl)-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 7258924 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (2S,6R,7R)-4-(3-methoxyphenyl)-7-(4-methylphenyl)-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione |
| SMILES | COc1cccc(N2C(=O)[C@H]3[C@@H](C2=O)N2CCCN2[C@H]3c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C22H23N3O3/c1-14-7-9-15(10-8-14)19-18-20(24-12-4-11-23(19)24)22(27)25(21(18)26)16-5-3-6-17(13-16)28-2/h3,5-10,13,18-20H,4,11-12H2,1-2H3/t18-,19+,20+/m1/s1 |
| InChIKey | XYGKUGZWLMVTJR-AABGKKOBSA-N |
| XLogP | 2.54 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|