C22H21Cl2IN3O6S2+ — CID 72589668
2-[2-[2-[[5,6-dichloro-1-ethyl-3-(sulfomethyl)benzimidazol-2-ylidene]methyl]but-1-enyl]-5-iodothieno[3,2-d][1,3]oxazol-1-ium-1-yl]acetic acid (PubChem CID 72589668) has the molecular formula C22H21Cl2IN3O6S2+ and a molecular weight of 685.37 g/mol. Its IUPAC name is 2-[2-[2-[[5,6-dichloro-1-ethyl-3-(sulfomethyl)benzimidazol-2-ylidene]methyl]but-1-enyl]-5-iodothieno[3,2-d][1,3]oxazol-1-ium-1-yl]acetic acid.
| Compound Name | 2-[2-[2-[[5,6-dichloro-1-ethyl-3-(sulfomethyl)benzimidazol-2-ylidene]methyl]but-1-enyl]-5-iodothieno[3,2-d][1,3]oxazol-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 72589668 |
| Molecular Formula | C22H21Cl2IN3O6S2+ |
| Molecular Weight | 685.37 g/mol |
| Exact Mass | 683.93 |
| IUPAC Name | 2-[2-[2-[[5,6-dichloro-1-ethyl-3-(sulfomethyl)benzimidazol-2-ylidene]methyl]but-1-enyl]-5-iodothieno[3,2-d][1,3]oxazol-1-ium-1-yl]acetic acid |
| SMILES | CCC(=Cc1oc2sc(I)cc2[n+]1CC(=O)O)C=C1N(CC)c2cc(Cl)c(Cl)cc2N1CS(=O)(=O)O |
| InChI | InChI=1S/C22H20Cl2IN3O6S2/c1-3-12(6-20-27(10-21(29)30)17-9-18(25)35-22(17)34-20)5-19-26(4-2)15-7-13(23)14(24)8-16(15)28(19)11-36(31,32)33/h5-9H,3-4,10-11H2,1-2H3,(H-,29,30,31,32,33)/p+1 |
| InChIKey | HLECZEMIXRSCBK-UHFFFAOYSA-O |
| XLogP | 5.60 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.37 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|