C21H18O6 — CID 72590212
1-(1-but-2-en-2-yloxyethenyl)-4,5,7-trihydroxy-2-methylanthracene-9,10-dione (PubChem CID 72590212) has the molecular formula C21H18O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is 1-(1-but-2-en-2-yloxyethenyl)-4,5,7-trihydroxy-2-methylanthracene-9,10-dione.
| Compound Name | 1-(1-but-2-en-2-yloxyethenyl)-4,5,7-trihydroxy-2-methylanthracene-9,10-dione |
|---|---|
| PubChem CID | 72590212 |
| Molecular Formula | C21H18O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-(1-but-2-en-2-yloxyethenyl)-4,5,7-trihydroxy-2-methylanthracene-9,10-dione |
| SMILES | C=C(OC(C)=CC)c1c(C)cc(O)c2c1C(=O)c1cc(O)cc(O)c1C2=O |
| InChI | InChI=1S/C21H18O6/c1-5-10(3)27-11(4)16-9(2)6-14(23)18-19(16)20(25)13-7-12(22)8-15(24)17(13)21(18)26/h5-8,22-24H,4H2,1-3H3 |
| InChIKey | RGMXMHSPFYOGSN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|