About 8-isocyanatodeca-1,6,8-triene
8-isocyanatodeca-1,6,8-triene (PubChem CID 72591865) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 8-isocyanatodeca-1,6,8-triene.
Molecular Properties
| Compound Name | 8-isocyanatodeca-1,6,8-triene |
| PubChem CID | 72591865 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 8-isocyanatodeca-1,6,8-triene |
| SMILES | C=CCCCC=CC(=CC)N=C=O |
| InChI | InChI=1S/C11H15NO/c1-3-5-6-7-8-9-11(4-2)12-10-13/h3-4,8-9H,1,5-7H2,2H3 |
| InChIKey | ILOAEDBBYXSTQQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 8-isocyanatodeca-1,6,8-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-isocyanatodeca-1,6,8-triene?
The IUPAC name of 8-isocyanatodeca-1,6,8-triene (CID 72591865) is 8-isocyanatodeca-1,6,8-triene.
What is the SMILES notation for 8-isocyanatodeca-1,6,8-triene?
The canonical SMILES for 8-isocyanatodeca-1,6,8-triene is C=CCCCC=CC(=CC)N=C=O.
What is the InChIKey of 8-isocyanatodeca-1,6,8-triene?
The InChIKey is ILOAEDBBYXSTQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-3-5-6-7-8-9-11(4-2)12-10-13/h3-4,8-9H,1,5-7H2,2H3.
What are the key properties of 8-isocyanatodeca-1,6,8-triene?
8-isocyanatodeca-1,6,8-triene has a molecular weight of 177.25 g/mol, XLogP of 3.14, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-isocyanatodeca-1,6,8-triene is sourced from PubChem (CID 72591865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).