About 3-(chlorosulfonylmethyl)-2-prop-1-enylcyclohexa-1,5-diene-1-sulfonyl chloride
3-(chlorosulfonylmethyl)-2-prop-1-enylcyclohexa-1,5-diene-1-sulfonyl chloride (PubChem CID 72591870) has the molecular formula C10H12Cl2O4S2
and a molecular weight of 331.24 g/mol. Its IUPAC name is 3-(chlorosulfonylmethyl)-2-prop-1-enylcyclohexa-1,5-diene-1-sulfonyl chloride.
Molecular Properties
| Compound Name | 3-(chlorosulfonylmethyl)-2-prop-1-enylcyclohexa-1,5-diene-1-sulfonyl chloride |
| PubChem CID | 72591870 |
| Molecular Formula | C10H12Cl2O4S2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 3-(chlorosulfonylmethyl)-2-prop-1-enylcyclohexa-1,5-diene-1-sulfonyl chloride |
| SMILES | CC=CC1=C(S(=O)(=O)Cl)C=CCC1CS(=O)(=O)Cl |
| InChI | InChI=1S/C10H12Cl2O4S2/c1-2-4-9-8(7-17(11,13)14)5-3-6-10(9)18(12,15)16/h2-4,6,8H,5,7H2,1H3 |
| InChIKey | LABZLCLPNHFUAQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(chlorosulfonylmethyl)-2-prop-1-enylcyclohexa-1,5-diene-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chlorosulfonylmethyl)-2-prop-1-enylcyclohexa-1,5-diene-1-sulfonyl chloride?
The IUPAC name of 3-(chlorosulfonylmethyl)-2-prop-1-enylcyclohexa-1,5-diene-1-sulfonyl chloride (CID 72591870) is 3-(chlorosulfonylmethyl)-2-prop-1-enylcyclohexa-1,5-diene-1-sulfonyl chloride.
What is the SMILES notation for 3-(chlorosulfonylmethyl)-2-prop-1-enylcyclohexa-1,5-diene-1-sulfonyl chloride?
The canonical SMILES for 3-(chlorosulfonylmethyl)-2-prop-1-enylcyclohexa-1,5-diene-1-sulfonyl chloride is CC=CC1=C(S(=O)(=O)Cl)C=CCC1CS(=O)(=O)Cl.
What is the InChIKey of 3-(chlorosulfonylmethyl)-2-prop-1-enylcyclohexa-1,5-diene-1-sulfonyl chloride?
The InChIKey is LABZLCLPNHFUAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Cl2O4S2/c1-2-4-9-8(7-17(11,13)14)5-3-6-10(9)18(12,15)16/h2-4,6,8H,5,7H2,1H3.
What are the key properties of 3-(chlorosulfonylmethyl)-2-prop-1-enylcyclohexa-1,5-diene-1-sulfonyl chloride?
3-(chlorosulfonylmethyl)-2-prop-1-enylcyclohexa-1,5-diene-1-sulfonyl chloride has a molecular weight of 331.24 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chlorosulfonylmethyl)-2-prop-1-enylcyclohexa-1,5-diene-1-sulfonyl chloride is sourced from PubChem (CID 72591870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).