C25H21N4O6S2- — CID 72592692
[8-isocyano-2-[4-(methanesulfonamido)benzoyl]-9-[4-(methanesulfonamido)phenyl]-9-oxonona-1,3,5,7-tetraenylidene]azanide (PubChem CID 72592692) has the molecular formula C25H21N4O6S2- and a molecular weight of 537.60 g/mol. Its IUPAC name is [8-isocyano-2-[4-(methanesulfonamido)benzoyl]-9-[4-(methanesulfonamido)phenyl]-9-oxonona-1,3,5,7-tetraenylidene]azanide.
| Compound Name | [8-isocyano-2-[4-(methanesulfonamido)benzoyl]-9-[4-(methanesulfonamido)phenyl]-9-oxonona-1,3,5,7-tetraenylidene]azanide |
|---|---|
| PubChem CID | 72592692 |
| Molecular Formula | C25H21N4O6S2- |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | [8-isocyano-2-[4-(methanesulfonamido)benzoyl]-9-[4-(methanesulfonamido)phenyl]-9-oxonona-1,3,5,7-tetraenylidene]azanide |
| SMILES | [C-]#[N+]C(=CC=CC=CC(=C=[N-])C(=O)c1ccc(NS(C)(=O)=O)cc1)C(=O)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C25H21N4O6S2/c1-27-23(25(31)19-11-15-22(16-12-19)29-37(3,34)35)8-6-4-5-7-20(17-26)24(30)18-9-13-21(14-10-18)28-36(2,32)33/h4-16,28-29H,2-3H3/q-1 |
| InChIKey | CFEQJPWDQWYANH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 153.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|