About 3,7-dimethylocta-2,6-diene-1-sulfinate
3,7-dimethylocta-2,6-diene-1-sulfinate (PubChem CID 72593133) has the molecular formula C10H17O2S-
and a molecular weight of 201.31 g/mol. Its IUPAC name is 3,7-dimethylocta-2,6-diene-1-sulfinate.
Molecular Properties
| Compound Name | 3,7-dimethylocta-2,6-diene-1-sulfinate |
| PubChem CID | 72593133 |
| Molecular Formula | C10H17O2S- |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 3,7-dimethylocta-2,6-diene-1-sulfinate |
| SMILES | CC(C)=CCCC(C)=CCS(=O)[O-] |
| InChI | InChI=1S/C10H18O2S/c1-9(2)5-4-6-10(3)7-8-13(11)12/h5,7H,4,6,8H2,1-3H3,(H,11,12)/p-1 |
| InChIKey | BTMGVYBBQDNHEH-UHFFFAOYSA-M |
| XLogP | 2.56 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethylocta-2,6-diene-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethylocta-2,6-diene-1-sulfinate?
The IUPAC name of 3,7-dimethylocta-2,6-diene-1-sulfinate (CID 72593133) is 3,7-dimethylocta-2,6-diene-1-sulfinate.
What is the SMILES notation for 3,7-dimethylocta-2,6-diene-1-sulfinate?
The canonical SMILES for 3,7-dimethylocta-2,6-diene-1-sulfinate is CC(C)=CCCC(C)=CCS(=O)[O-].
What is the InChIKey of 3,7-dimethylocta-2,6-diene-1-sulfinate?
The InChIKey is BTMGVYBBQDNHEH-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H18O2S/c1-9(2)5-4-6-10(3)7-8-13(11)12/h5,7H,4,6,8H2,1-3H3,(H,11,12)/p-1.
What are the key properties of 3,7-dimethylocta-2,6-diene-1-sulfinate?
3,7-dimethylocta-2,6-diene-1-sulfinate has a molecular weight of 201.31 g/mol, XLogP of 2.56, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethylocta-2,6-diene-1-sulfinate is sourced from PubChem (CID 72593133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).