C42H40ClN2O6S2+ — CID 72594002
3-[2-[2-chloro-3-[2-(4-propyl-7-sulfobenzo[f]quinolin-4-ium-3-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-4-propylbenzo[f]quinoline-7-sulfonic acid (PubChem CID 72594002) has the molecular formula C42H40ClN2O6S2+ and a molecular weight of 768.38 g/mol. Its IUPAC name is 3-[2-[2-chloro-3-[2-(4-propyl-7-sulfobenzo[f]quinolin-4-ium-3-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-4-propylbenzo[f]quinoline-7-sulfonic acid.
| Compound Name | 3-[2-[2-chloro-3-[2-(4-propyl-7-sulfobenzo[f]quinolin-4-ium-3-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-4-propylbenzo[f]quinoline-7-sulfonic acid |
|---|---|
| PubChem CID | 72594002 |
| Molecular Formula | C42H40ClN2O6S2+ |
| Molecular Weight | 768.38 g/mol |
| Exact Mass | 767.20 |
| IUPAC Name | 3-[2-[2-chloro-3-[2-(4-propyl-7-sulfobenzo[f]quinolin-4-ium-3-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-4-propylbenzo[f]quinoline-7-sulfonic acid |
| SMILES | CCCN1C(=CC=C2CCCC(C=Cc3ccc4c5cccc(S(=O)(=O)O)c5ccc4[n+]3CCC)=C2Cl)C=Cc2c1ccc1c(S(=O)(=O)O)cccc21 |
| InChI | InChI=1S/C42H39ClN2O6S2/c1-3-26-44-30(18-20-34-32-10-6-12-40(52(46,47)48)36(32)22-24-38(34)44)16-14-28-8-5-9-29(42(28)43)15-17-31-19-21-35-33-11-7-13-41(53(49,50)51)37(33)23-25-39(35)45(31)27-4-2/h6-7,10-25H,3-5,8-9,26-27H2,1-2H3,(H-,46,47,48,49,50,51)/p+1 |
| InChIKey | JPZZIGFCPVYMOC-UHFFFAOYSA-O |
| XLogP | 9.78 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.38 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|