About N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcyclohexanecarboxamide
N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcyclohexanecarboxamide (PubChem CID 7259495) has the molecular formula C12H21NO3S
and a molecular weight of 259.37 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcyclohexanecarboxamide |
| PubChem CID | 7259495 |
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcyclohexanecarboxamide |
| SMILES | CN(C(=O)C1CCCCC1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H21NO3S/c1-13(11-7-8-17(15,16)9-11)12(14)10-5-3-2-4-6-10/h10-11H,2-9H2,1H3/t11-/m1/s1 |
| InChIKey | BARYZANWYBXOAC-LLVKDONJSA-N |
| XLogP | 1.21 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcyclohexanecarboxamide?
The IUPAC name of N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcyclohexanecarboxamide (CID 7259495) is N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcyclohexanecarboxamide.
What is the SMILES notation for N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcyclohexanecarboxamide?
The canonical SMILES for N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcyclohexanecarboxamide is CN(C(=O)C1CCCCC1)[C@@H]1CCS(=O)(=O)C1.
What is the InChIKey of N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcyclohexanecarboxamide?
The InChIKey is BARYZANWYBXOAC-LLVKDONJSA-N. The full InChI is InChI=1S/C12H21NO3S/c1-13(11-7-8-17(15,16)9-11)12(14)10-5-3-2-4-6-10/h10-11H,2-9H2,1H3/t11-/m1/s1.
What are the key properties of N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcyclohexanecarboxamide?
N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcyclohexanecarboxamide has a molecular weight of 259.37 g/mol, XLogP of 1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcyclohexanecarboxamide is sourced from PubChem (CID 7259495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).