About 4-tert-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)benzamide
4-tert-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)benzamide (PubChem CID 7259552) has the molecular formula C19H29NO3S
and a molecular weight of 351.51 g/mol. Its IUPAC name is 4-tert-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)benzamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)benzamide |
| PubChem CID | 7259552 |
| Molecular Formula | C19H29NO3S |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-tert-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(C(=O)c1ccc(C(C)(C)C)cc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H29NO3S/c1-14(2)12-20(17-10-11-24(22,23)13-17)18(21)15-6-8-16(9-7-15)19(3,4)5/h6-9,14,17H,10-13H2,1-5H3/t17-/m1/s1 |
| InChIKey | HNLQJQYCBWYAPA-QGZVFWFLSA-N |
| XLogP | 3.27 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)benzamide?
The IUPAC name of 4-tert-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)benzamide (CID 7259552) is 4-tert-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)benzamide.
What is the SMILES notation for 4-tert-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)benzamide?
The canonical SMILES for 4-tert-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)benzamide is CC(C)CN(C(=O)c1ccc(C(C)(C)C)cc1)[C@@H]1CCS(=O)(=O)C1.
What is the InChIKey of 4-tert-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)benzamide?
The InChIKey is HNLQJQYCBWYAPA-QGZVFWFLSA-N. The full InChI is InChI=1S/C19H29NO3S/c1-14(2)12-20(17-10-11-24(22,23)13-17)18(21)15-6-8-16(9-7-15)19(3,4)5/h6-9,14,17H,10-13H2,1-5H3/t17-/m1/s1.
What are the key properties of 4-tert-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)benzamide?
4-tert-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)benzamide has a molecular weight of 351.51 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)benzamide is sourced from PubChem (CID 7259552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).