C15H25NO4 — CID 72596565
tert-butyl 2,2-dimethyl-4,6,9,9a-tetrahydro-3aH-oxocino[4,3-d][1,3]oxazole-1-carboxylate (PubChem CID 72596565) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-4,6,9,9a-tetrahydro-3aH-oxocino[4,3-d][1,3]oxazole-1-carboxylate.
| Compound Name | tert-butyl 2,2-dimethyl-4,6,9,9a-tetrahydro-3aH-oxocino[4,3-d][1,3]oxazole-1-carboxylate |
|---|---|
| PubChem CID | 72596565 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | tert-butyl 2,2-dimethyl-4,6,9,9a-tetrahydro-3aH-oxocino[4,3-d][1,3]oxazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CC=CCOCC2OC1(C)C |
| InChI | InChI=1S/C15H25NO4/c1-14(2,3)20-13(17)16-11-8-6-7-9-18-10-12(11)19-15(16,4)5/h6-7,11-12H,8-10H2,1-5H3 |
| InChIKey | MLZWGBGJYWYBES-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|