About 1'-(benzenesulfonyl)spiro[3H-chromene-2,4'-piperidine]-4-one
1'-(benzenesulfonyl)spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 7260661) has the molecular formula C19H19NO4S
and a molecular weight of 357.43 g/mol. Its IUPAC name is 1'-(benzenesulfonyl)spiro[3H-chromene-2,4'-piperidine]-4-one.
Molecular Properties
| Compound Name | 1'-(benzenesulfonyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
| PubChem CID | 7260661 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 1'-(benzenesulfonyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | O=C1CC2(CCN(S(=O)(=O)c3ccccc3)CC2)Oc2ccccc21 |
| InChI | InChI=1S/C19H19NO4S/c21-17-14-19(24-18-9-5-4-8-16(17)18)10-12-20(13-11-19)25(22,23)15-6-2-1-3-7-15/h1-9H,10-14H2 |
| InChIKey | PEXZVMNKODCNJN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1'-(benzenesulfonyl)spiro[3H-chromene-2,4'-piperidine]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(benzenesulfonyl)spiro[3H-chromene-2,4'-piperidine]-4-one?
The IUPAC name of 1'-(benzenesulfonyl)spiro[3H-chromene-2,4'-piperidine]-4-one (CID 7260661) is 1'-(benzenesulfonyl)spiro[3H-chromene-2,4'-piperidine]-4-one.
What is the SMILES notation for 1'-(benzenesulfonyl)spiro[3H-chromene-2,4'-piperidine]-4-one?
The canonical SMILES for 1'-(benzenesulfonyl)spiro[3H-chromene-2,4'-piperidine]-4-one is O=C1CC2(CCN(S(=O)(=O)c3ccccc3)CC2)Oc2ccccc21.
What is the InChIKey of 1'-(benzenesulfonyl)spiro[3H-chromene-2,4'-piperidine]-4-one?
The InChIKey is PEXZVMNKODCNJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO4S/c21-17-14-19(24-18-9-5-4-8-16(17)18)10-12-20(13-11-19)25(22,23)15-6-2-1-3-7-15/h1-9H,10-14H2.
What are the key properties of 1'-(benzenesulfonyl)spiro[3H-chromene-2,4'-piperidine]-4-one?
1'-(benzenesulfonyl)spiro[3H-chromene-2,4'-piperidine]-4-one has a molecular weight of 357.43 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(benzenesulfonyl)spiro[3H-chromene-2,4'-piperidine]-4-one is sourced from PubChem (CID 7260661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).