C19H22N4O5 — CID 72607692
1-[2-(4-butoxypyrimidin-2-yl)oxyphenyl]-1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxymethanimine (PubChem CID 72607692) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is 1-[2-(4-butoxypyrimidin-2-yl)oxyphenyl]-1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxymethanimine.
| Compound Name | 1-[2-(4-butoxypyrimidin-2-yl)oxyphenyl]-1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxymethanimine |
|---|---|
| PubChem CID | 72607692 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 1-[2-(4-butoxypyrimidin-2-yl)oxyphenyl]-1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxymethanimine |
| SMILES | CCCCOc1ccnc(Oc2ccccc2C(=NOC)C2=NOCCO2)n1 |
| InChI | InChI=1S/C19H22N4O5/c1-3-4-11-25-16-9-10-20-19(21-16)28-15-8-6-5-7-14(15)17(22-24-2)18-23-27-13-12-26-18/h5-10H,3-4,11-13H2,1-2H3 |
| InChIKey | KCKWTPJGENOEHF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|