C25H33NO2 — CID 72608180
2-(methylperoxymethyl)-5-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-en-2-yl]pyridine (PubChem CID 72608180) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is 2-(methylperoxymethyl)-5-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-en-2-yl]pyridine.
| Compound Name | 2-(methylperoxymethyl)-5-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-en-2-yl]pyridine |
|---|---|
| PubChem CID | 72608180 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 2-(methylperoxymethyl)-5-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-en-2-yl]pyridine |
| SMILES | COOCc1ccc(C(C)=Cc2cc3c(cc2C)C(C)(C)CCC3(C)C)cn1 |
| InChI | InChI=1S/C25H33NO2/c1-17(19-8-9-21(26-15-19)16-28-27-7)12-20-14-23-22(13-18(20)2)24(3,4)10-11-25(23,5)6/h8-9,12-15H,10-11,16H2,1-7H3 |
| InChIKey | DWBAWLZXCHMSLU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|