About N-ethyl-2,3-dimethoxybut-2-enamide
N-ethyl-2,3-dimethoxybut-2-enamide (PubChem CID 72608275) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is N-ethyl-2,3-dimethoxybut-2-enamide.
Molecular Properties
| Compound Name | N-ethyl-2,3-dimethoxybut-2-enamide |
| PubChem CID | 72608275 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | N-ethyl-2,3-dimethoxybut-2-enamide |
| SMILES | CCNC(=O)C(OC)=C(C)OC |
| InChI | InChI=1S/C8H15NO3/c1-5-9-8(10)7(12-4)6(2)11-3/h5H2,1-4H3,(H,9,10) |
| InChIKey | XMMBPWQHXMBBRY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2,3-dimethoxybut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,3-dimethoxybut-2-enamide?
The IUPAC name of N-ethyl-2,3-dimethoxybut-2-enamide (CID 72608275) is N-ethyl-2,3-dimethoxybut-2-enamide.
What is the SMILES notation for N-ethyl-2,3-dimethoxybut-2-enamide?
The canonical SMILES for N-ethyl-2,3-dimethoxybut-2-enamide is CCNC(=O)C(OC)=C(C)OC.
What is the InChIKey of N-ethyl-2,3-dimethoxybut-2-enamide?
The InChIKey is XMMBPWQHXMBBRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-5-9-8(10)7(12-4)6(2)11-3/h5H2,1-4H3,(H,9,10).
What are the key properties of N-ethyl-2,3-dimethoxybut-2-enamide?
N-ethyl-2,3-dimethoxybut-2-enamide has a molecular weight of 173.21 g/mol, XLogP of 0.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,3-dimethoxybut-2-enamide is sourced from PubChem (CID 72608275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).