C20H13Br2NOS — CID 72608334
3-[(3,5-dibromo-4-methylphenyl)methylidene]-5-thiophen-3-yl-1H-indol-2-one (PubChem CID 72608334) has the molecular formula C20H13Br2NOS and a molecular weight of 475.21 g/mol. Its IUPAC name is 3-[(3,5-dibromo-4-methylphenyl)methylidene]-5-thiophen-3-yl-1H-indol-2-one.
| Compound Name | 3-[(3,5-dibromo-4-methylphenyl)methylidene]-5-thiophen-3-yl-1H-indol-2-one |
|---|---|
| PubChem CID | 72608334 |
| Molecular Formula | C20H13Br2NOS |
| Molecular Weight | 475.21 g/mol |
| Exact Mass | 472.91 |
| IUPAC Name | 3-[(3,5-dibromo-4-methylphenyl)methylidene]-5-thiophen-3-yl-1H-indol-2-one |
| SMILES | Cc1c(Br)cc(C=C2C(=O)Nc3ccc(-c4ccsc4)cc32)cc1Br |
| InChI | InChI=1S/C20H13Br2NOS/c1-11-17(21)7-12(8-18(11)22)6-16-15-9-13(14-4-5-25-10-14)2-3-19(15)23-20(16)24/h2-10H,1H3,(H,23,24) |
| InChIKey | CIIVVTLTRXDZHD-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.21 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|