About N-[[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]-dimethylazaniumyl]ethanimidate
N-[[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]-dimethylazaniumyl]ethanimidate (PubChem CID 72608549) has the molecular formula C8H18N4O2
and a molecular weight of 202.26 g/mol. Its IUPAC name is N-[[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]-dimethylazaniumyl]ethanimidate.
Molecular Properties
| Compound Name | N-[[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]-dimethylazaniumyl]ethanimidate |
| PubChem CID | 72608549 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | N-[[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]-dimethylazaniumyl]ethanimidate |
| SMILES | CC([O-])=N[N+](C)(C)CC(=O)NN(C)C |
| InChI | InChI=1S/C8H18N4O2/c1-7(13)10-12(4,5)6-8(14)9-11(2)3/h6H2,1-5H3,(H-,9,10,13,14) |
| InChIKey | KWDFHPZNVFANJY-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N-[[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]-dimethylazaniumyl]ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]-dimethylazaniumyl]ethanimidate?
The IUPAC name of N-[[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]-dimethylazaniumyl]ethanimidate (CID 72608549) is N-[[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]-dimethylazaniumyl]ethanimidate.
What is the SMILES notation for N-[[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]-dimethylazaniumyl]ethanimidate?
The canonical SMILES for N-[[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]-dimethylazaniumyl]ethanimidate is CC([O-])=N[N+](C)(C)CC(=O)NN(C)C.
What is the InChIKey of N-[[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]-dimethylazaniumyl]ethanimidate?
The InChIKey is KWDFHPZNVFANJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4O2/c1-7(13)10-12(4,5)6-8(14)9-11(2)3/h6H2,1-5H3,(H-,9,10,13,14).
What are the key properties of N-[[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]-dimethylazaniumyl]ethanimidate?
N-[[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]-dimethylazaniumyl]ethanimidate has a molecular weight of 202.26 g/mol, XLogP of -1.65, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]-dimethylazaniumyl]ethanimidate is sourced from PubChem (CID 72608549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).