C25H36O4Si — CID 72610012
2-[5-[[4-(ethoxymethyl)phenyl]-diethylsilyl]oxypent-1-enyl]-4-methoxyphenol (PubChem CID 72610012) has the molecular formula C25H36O4Si and a molecular weight of 428.65 g/mol. Its IUPAC name is 2-[5-[[4-(ethoxymethyl)phenyl]-diethylsilyl]oxypent-1-enyl]-4-methoxyphenol.
| Compound Name | 2-[5-[[4-(ethoxymethyl)phenyl]-diethylsilyl]oxypent-1-enyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 72610012 |
| Molecular Formula | C25H36O4Si |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 2-[5-[[4-(ethoxymethyl)phenyl]-diethylsilyl]oxypent-1-enyl]-4-methoxyphenol |
| SMILES | CCOCc1ccc([Si](CC)(CC)OCCCC=Cc2cc(OC)ccc2O)cc1 |
| InChI | InChI=1S/C25H36O4Si/c1-5-28-20-21-12-15-24(16-13-21)30(6-2,7-3)29-18-10-8-9-11-22-19-23(27-4)14-17-25(22)26/h9,11-17,19,26H,5-8,10,18,20H2,1-4H3 |
| InChIKey | NBDGRVSAFWVYMB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|