C13H14O4S — CID 72610306
2-(5-cyclohexa-2,4-dien-1-ylidenepenta-1,3-dien-2-ylsulfonyl)acetic acid (PubChem CID 72610306) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-(5-cyclohexa-2,4-dien-1-ylidenepenta-1,3-dien-2-ylsulfonyl)acetic acid.
| Compound Name | 2-(5-cyclohexa-2,4-dien-1-ylidenepenta-1,3-dien-2-ylsulfonyl)acetic acid |
|---|---|
| PubChem CID | 72610306 |
| Molecular Formula | C13H14O4S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-(5-cyclohexa-2,4-dien-1-ylidenepenta-1,3-dien-2-ylsulfonyl)acetic acid |
| SMILES | C=C(C=CC=C1C=CC=CC1)S(=O)(=O)CC(=O)O |
| InChI | InChI=1S/C13H14O4S/c1-11(18(16,17)10-13(14)15)6-5-9-12-7-3-2-4-8-12/h2-7,9H,1,8,10H2,(H,14,15) |
| InChIKey | BKQJZZIKOGNQFJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|