C42H60O2 — CID 72611010
3-methoxy-6-[18-(4-methoxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-1,5,5-trimethylcyclohexene (PubChem CID 72611010) has the molecular formula C42H60O2 and a molecular weight of 596.94 g/mol. Its IUPAC name is 3-methoxy-6-[18-(4-methoxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-1,5,5-trimethylcyclohexene.
| Compound Name | 3-methoxy-6-[18-(4-methoxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-1,5,5-trimethylcyclohexene |
|---|---|
| PubChem CID | 72611010 |
| Molecular Formula | C42H60O2 |
| Molecular Weight | 596.94 g/mol |
| Exact Mass | 596.46 |
| IUPAC Name | 3-methoxy-6-[18-(4-methoxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-1,5,5-trimethylcyclohexene |
| SMILES | COC1C=C(C)C(C=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC2=C(C)CC(OC)CC2(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C42H60O2/c1-31(19-15-21-33(3)23-25-39-35(5)27-37(43-11)29-41(39,7)8)17-13-14-18-32(2)20-16-22-34(4)24-26-40-36(6)28-38(44-12)30-42(40,9)10/h13-27,37-39H,28-30H2,1-12H3 |
| InChIKey | OZILPOACCXVHBN-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.94 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|