C14H21ClN2O2S — CID 7261109
4-[(2S,4S)-2-chloro-4,6,6-trimethyl-2-methylsulfanyl-1,3-diazinan-4-yl]benzene-1,3-diol (PubChem CID 7261109) has the molecular formula C14H21ClN2O2S and a molecular weight of 316.85 g/mol. Its IUPAC name is 4-[(2S,4S)-2-chloro-4,6,6-trimethyl-2-methylsulfanyl-1,3-diazinan-4-yl]benzene-1,3-diol.
| Compound Name | 4-[(2S,4S)-2-chloro-4,6,6-trimethyl-2-methylsulfanyl-1,3-diazinan-4-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 7261109 |
| Molecular Formula | C14H21ClN2O2S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-[(2S,4S)-2-chloro-4,6,6-trimethyl-2-methylsulfanyl-1,3-diazinan-4-yl]benzene-1,3-diol |
| SMILES | CS[C@]1(Cl)NC(C)(C)C[C@@](C)(c2ccc(O)cc2O)N1 |
| InChI | InChI=1S/C14H21ClN2O2S/c1-12(2)8-13(3,17-14(15,16-12)20-4)10-6-5-9(18)7-11(10)19/h5-7,16-19H,8H2,1-4H3/t13-,14+/m0/s1 |
| InChIKey | ANRDLEXXSGALEV-UONOGXRCSA-N |
| XLogP | 2.89 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|